C18H19F7N2O3 — CID 42561930
(2R)-1-[(5R)-3-tert-butyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-4H-pyrazol-1-yl]-2-hydroxy-2-phenylethanone (PubChem CID 42561930) has the molecular formula C18H19F7N2O3 and a molecular weight of 444.35 g/mol. Its IUPAC name is (2R)-1-[(5R)-3-tert-butyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-4H-pyrazol-1-yl]-2-hydroxy-2-phenylethanone.
| Compound Name | (2R)-1-[(5R)-3-tert-butyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-4H-pyrazol-1-yl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 42561930 |
| Molecular Formula | C18H19F7N2O3 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (2R)-1-[(5R)-3-tert-butyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-4H-pyrazol-1-yl]-2-hydroxy-2-phenylethanone |
| SMILES | CC(C)(C)C1=NN(C(=O)[C@H](O)c2ccccc2)[C@](O)(C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H19F7N2O3/c1-14(2,3)11-9-15(30,16(19,20)17(21,22)18(23,24)25)27(26-11)13(29)12(28)10-7-5-4-6-8-10/h4-8,12,28,30H,9H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | BTVWJUMBRVINOZ-IUODEOHRSA-N |
| XLogP | 3.88 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|