C20H13Cl2F7N2O3 — CID 45146536
2-(2,4-dichlorophenoxy)-1-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-3-phenyl-4H-pyrazol-1-yl]ethanone (PubChem CID 45146536) has the molecular formula C20H13Cl2F7N2O3 and a molecular weight of 533.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-3-phenyl-4H-pyrazol-1-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-3-phenyl-4H-pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 45146536 |
| Molecular Formula | C20H13Cl2F7N2O3 |
| Molecular Weight | 533.23 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-3-phenyl-4H-pyrazol-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1N=C(c2ccccc2)CC1(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H13Cl2F7N2O3/c21-12-6-7-15(13(22)8-12)34-10-16(32)31-17(33,18(23,24)19(25,26)20(27,28)29)9-14(30-31)11-4-2-1-3-5-11/h1-8,33H,9-10H2 |
| InChIKey | RAZVPGJOQCCBRE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.23 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|