C19H13Cl2F5N2O3 — CID 35260204
2-(2,4-dichlorophenoxy)-1-[(5S)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazol-1-yl]ethanone (PubChem CID 35260204) has the molecular formula C19H13Cl2F5N2O3 and a molecular weight of 483.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[(5S)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazol-1-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[(5S)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 35260204 |
| Molecular Formula | C19H13Cl2F5N2O3 |
| Molecular Weight | 483.22 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[(5S)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazol-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1N=C(c2ccccc2)C[C@]1(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H13Cl2F5N2O3/c20-12-6-7-15(13(21)8-12)31-10-16(29)28-17(30,18(22,23)19(24,25)26)9-14(27-28)11-4-2-1-3-5-11/h1-8,30H,9-10H2/t17-/m0/s1 |
| InChIKey | HENDEURZHJTGTQ-KRWDZBQOSA-N |
| XLogP | 4.89 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.22 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|