C16H16BrF3N2O4 — CID 39347799
tert-butyl 2-[(5R)-3-(4-bromophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-oxoacetate (PubChem CID 39347799) has the molecular formula C16H16BrF3N2O4 and a molecular weight of 437.21 g/mol. Its IUPAC name is tert-butyl 2-[(5R)-3-(4-bromophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-oxoacetate.
| Compound Name | tert-butyl 2-[(5R)-3-(4-bromophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 39347799 |
| Molecular Formula | C16H16BrF3N2O4 |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | tert-butyl 2-[(5R)-3-(4-bromophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-oxoacetate |
| SMILES | CC(C)(C)OC(=O)C(=O)N1N=C(c2ccc(Br)cc2)C[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C16H16BrF3N2O4/c1-14(2,3)26-13(24)12(23)22-15(25,16(18,19)20)8-11(21-22)9-4-6-10(17)7-5-9/h4-7,25H,8H2,1-3H3/t15-/m1/s1 |
| InChIKey | YEYKXKBWCGYXBM-OAHLLOKOSA-N |
| XLogP | 2.98 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|