C16H25F3N2O3 — CID 126348653
ethyl (3R,3aR,5S)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazole-2-carboxylate (PubChem CID 126348653) has the molecular formula C16H25F3N2O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is ethyl (3R,3aR,5S)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazole-2-carboxylate.
| Compound Name | ethyl (3R,3aR,5S)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazole-2-carboxylate |
|---|---|
| PubChem CID | 126348653 |
| Molecular Formula | C16H25F3N2O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ethyl (3R,3aR,5S)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazole-2-carboxylate |
| SMILES | CCOC(=O)N1N=C2CC[C@H](C(C)(C)CC)C[C@H]2[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C16H25F3N2O3/c1-5-14(3,4)10-7-8-12-11(9-10)15(23,16(17,18)19)21(20-12)13(22)24-6-2/h10-11,23H,5-9H2,1-4H3/t10-,11+,15+/m0/s1 |
| InChIKey | GVWXPHVSTHJFDU-FIXISWKDSA-N |
| XLogP | 3.92 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |