C22H29F3N2O3 — CID 126352630
1-[(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 126352630) has the molecular formula C22H29F3N2O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is 1-[(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 126352630 |
| Molecular Formula | C22H29F3N2O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | CCC(C)(C)[C@@H]1CCC2=NN(C(=O)Cc3ccc(OC)cc3)[C@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C22H29F3N2O3/c1-5-20(2,3)15-8-11-18-17(13-15)21(29,22(23,24)25)27(26-18)19(28)12-14-6-9-16(30-4)10-7-14/h6-7,9-10,15,17,29H,5,8,11-13H2,1-4H3/t15-,17+,21-/m1/s1 |
| InChIKey | PKZLVDLTLSUQPY-LDBYXDLTSA-N |
| XLogP | 4.54 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |