C18H21F3N2O3 — CID 126187344
1-[(3S,3aR,7R)-3-hydroxy-7-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 126187344) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-[(3S,3aR,7R)-3-hydroxy-7-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[(3S,3aR,7R)-3-hydroxy-7-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 126187344 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[(3S,3aR,7R)-3-hydroxy-7-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2N=C3[C@H](C)CCC[C@H]3[C@]2(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3N2O3/c1-11-4-3-5-14-16(11)22-23(17(14,25)18(19,20)21)15(24)10-12-6-8-13(26-2)9-7-12/h6-9,11,14,25H,3-5,10H2,1-2H3/t11-,14-,17+/m1/s1 |
| InChIKey | VNWCKAQXALFLHF-ZLENFMNRSA-N |
| XLogP | 3.12 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |