C22H29F3N2O4 — CID 126100003
1-[(3S,3aR,5S)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(3,4-dimethoxyphenyl)ethanone (PubChem CID 126100003) has the molecular formula C22H29F3N2O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-[(3S,3aR,5S)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-[(3S,3aR,5S)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 126100003 |
| Molecular Formula | C22H29F3N2O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 1-[(3S,3aR,5S)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2N=C3CC[C@H](C(C)(C)C)C[C@H]3[C@]2(O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C22H29F3N2O4/c1-20(2,3)14-7-8-16-15(12-14)21(29,22(23,24)25)27(26-16)19(28)11-13-6-9-17(30-4)18(10-13)31-5/h6,9-10,14-15,29H,7-8,11-12H2,1-5H3/t14-,15+,21-/m0/s1 |
| InChIKey | BKZUMVBVUZCBCS-ZSDSOXJFSA-N |
| XLogP | 4.16 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |