C21H25Cl2F3N2O3 — CID 126091847
(2S)-1-[(3R,3aR,5S)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(2,4-dichlorophenoxy)propan-1-one (PubChem CID 126091847) has the molecular formula C21H25Cl2F3N2O3 and a molecular weight of 481.34 g/mol. Its IUPAC name is (2S)-1-[(3R,3aR,5S)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(2,4-dichlorophenoxy)propan-1-one.
| Compound Name | (2S)-1-[(3R,3aR,5S)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(2,4-dichlorophenoxy)propan-1-one |
|---|---|
| PubChem CID | 126091847 |
| Molecular Formula | C21H25Cl2F3N2O3 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | (2S)-1-[(3R,3aR,5S)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(2,4-dichlorophenoxy)propan-1-one |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)N1N=C2CC[C@H](C(C)(C)C)C[C@H]2[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C21H25Cl2F3N2O3/c1-11(31-17-8-6-13(22)10-15(17)23)18(29)28-20(30,21(24,25)26)14-9-12(19(2,3)4)5-7-16(14)27-28/h6,8,10-12,14,30H,5,7,9H2,1-4H3/t11-,12-,14+,20+/m0/s1 |
| InChIKey | DAMYSSOBDOJQCP-VXHCHZMVSA-N |
| XLogP | 5.67 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |