C20H26ClIN4O2 — CID 111176116
N-[3-[[N'-[(3-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]-3-hydroxybenzamide;hydroiodide (PubChem CID 111176116) has the molecular formula C20H26ClIN4O2 and a molecular weight of 516.81 g/mol. Its IUPAC name is N-[3-[[N'-[(3-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]-3-hydroxybenzamide;hydroiodide.
| Compound Name | N-[3-[[N'-[(3-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]-3-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111176116 |
| Molecular Formula | C20H26ClIN4O2 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | N-[3-[[N'-[(3-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]-3-hydroxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cl)c1)NCCCNC(=O)c1cccc(O)c1.I |
| InChI | InChI=1S/C20H25ClN4O2.HI/c1-2-22-20(25-14-15-6-3-8-17(21)12-15)24-11-5-10-23-19(27)16-7-4-9-18(26)13-16;/h3-4,6-9,12-13,26H,2,5,10-11,14H2,1H3,(H,23,27)(H2,22,24,25);1H |
| InChIKey | JDFJNZDFCBJKQV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|