C23H33ClIN5O — CID 111357797
3-[[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide;hydroiodide (PubChem CID 111357797) has the molecular formula C23H33ClIN5O and a molecular weight of 557.91 g/mol. Its IUPAC name is 3-[[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide;hydroiodide.
| Compound Name | 3-[[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111357797 |
| Molecular Formula | C23H33ClIN5O |
| Molecular Weight | 557.91 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 3-[[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCCN(C)C)c1)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C23H32ClN5O.HI/c1-4-25-23(27-12-11-18-7-6-10-21(24)16-18)28-17-19-8-5-9-20(15-19)22(30)26-13-14-29(2)3;/h5-10,15-16H,4,11-14,17H2,1-3H3,(H,26,30)(H2,25,27,28);1H |
| InChIKey | NEXKBWNJRFWKEI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.91 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|