C22H40N6O2 — CID 111652128
N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-[2-[3-methoxypropyl(methyl)amino]ethylamino]methylidene]amino]methyl]benzamide (PubChem CID 111652128) has the molecular formula C22H40N6O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-[2-[3-methoxypropyl(methyl)amino]ethylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-[2-[3-methoxypropyl(methyl)amino]ethylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111652128 |
| Molecular Formula | C22H40N6O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-[2-[3-methoxypropyl(methyl)amino]ethylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCCN(C)C)c1)NCCN(C)CCCOC |
| InChI | InChI=1S/C22H40N6O2/c1-6-23-22(25-12-15-28(4)13-8-16-30-5)26-18-19-9-7-10-20(17-19)21(29)24-11-14-27(2)3/h7,9-10,17H,6,8,11-16,18H2,1-5H3,(H,24,29)(H2,23,25,26) |
| InChIKey | RAVITEOZLUAWHQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|