C18H29F3N4O — CID 111652066
1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111652066) has the molecular formula C18H29F3N4O and a molecular weight of 374.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111652066 |
| Molecular Formula | C18H29F3N4O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCN(C)CCCOC |
| InChI | InChI=1S/C18H29F3N4O/c1-4-22-17(23-9-11-25(2)10-6-12-26-3)24-14-15-7-5-8-16(13-15)18(19,20)21/h5,7-8,13H,4,6,9-12,14H2,1-3H3,(H2,22,23,24) |
| InChIKey | QJAOMPQZAVVBLA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|