C20H33N7O — CID 111652618
1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111652618) has the molecular formula C20H33N7O and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111652618 |
| Molecular Formula | C20H33N7O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cncn2)c1)NCCN(C)CCCOC |
| InChI | InChI=1S/C20H33N7O/c1-4-22-20(23-9-11-26(2)10-6-12-28-3)24-14-18-7-5-8-19(13-18)15-27-17-21-16-25-27/h5,7-8,13,16-17H,4,6,9-12,14-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | FSJMWBBPVDKYEL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|