C22H36N6O — CID 111652614
1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111652614) has the molecular formula C22H36N6O and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111652614 |
| Molecular Formula | C22H36N6O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2C)c1)NCCN(C)CCCOC |
| InChI | InChI=1S/C22H36N6O/c1-5-23-22(25-10-13-27(3)12-7-15-29-4)26-17-20-8-6-9-21(16-20)18-28-14-11-24-19(28)2/h6,8-9,11,14,16H,5,7,10,12-13,15,17-18H2,1-4H3,(H2,23,25,26) |
| InChIKey | IXOWBPGRGKQMEQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|