C20H26ClN3O3 — CID 111176882
1-[(3-chlorophenyl)methyl]-2-methyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine (PubChem CID 111176882) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2-methyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2-methyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111176882 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2-methyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1OC)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H26ClN3O3/c1-22-20(24-13-14-6-5-7-16(21)12-14)23-11-10-15-8-9-17(25-2)19(27-4)18(15)26-3/h5-9,12H,10-11,13H2,1-4H3,(H2,22,23,24) |
| InChIKey | OWAYNIBEDRWYLD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|