C23H34IN3O6 — CID 111377291
2-methyl-1-[2-(2,3,4-trimethoxyphenyl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111377291) has the molecular formula C23H34IN3O6 and a molecular weight of 575.44 g/mol. Its IUPAC name is 2-methyl-1-[2-(2,3,4-trimethoxyphenyl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(2,3,4-trimethoxyphenyl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111377291 |
| Molecular Formula | C23H34IN3O6 |
| Molecular Weight | 575.44 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 2-methyl-1-[2-(2,3,4-trimethoxyphenyl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(OC)c(OC)c1OC)NCc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C23H33N3O6.HI/c1-24-23(26-14-15-12-18(28-3)21(31-6)19(13-15)29-4)25-11-10-16-8-9-17(27-2)22(32-7)20(16)30-5;/h8-9,12-13H,10-11,14H2,1-7H3,(H2,24,25,26);1H |
| InChIKey | NDBGUIBDOSLPOK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|