C21H29N3O5 — CID 111202214
1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine (PubChem CID 111202214) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111202214 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(OC)c(OC)c1)NCc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C21H29N3O5/c1-22-21(23-12-14-7-9-16(25-2)18(11-14)27-4)24-13-15-8-10-17(26-3)20(29-6)19(15)28-5/h7-11H,12-13H2,1-6H3,(H2,22,23,24) |
| InChIKey | JTUDFLMXZQTXQZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|