C20H26IN3O5 — CID 111846012
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111846012) has the molecular formula C20H26IN3O5 and a molecular weight of 515.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111846012 |
| Molecular Formula | C20H26IN3O5 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCc1ccc(OC)c(OC)c1OC.I |
| InChI | InChI=1S/C20H25N3O5.HI/c1-21-20(22-10-13-5-7-15-17(9-13)28-12-27-15)23-11-14-6-8-16(24-2)19(26-4)18(14)25-3;/h5-9H,10-12H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | HUJNWSJRKDIMTM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|