C23H34IN3O4 — CID 111589068
1-[2-(3-methoxy-4-methylphenyl)ethyl]-2-methyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111589068) has the molecular formula C23H34IN3O4 and a molecular weight of 543.45 g/mol. Its IUPAC name is 1-[2-(3-methoxy-4-methylphenyl)ethyl]-2-methyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-methoxy-4-methylphenyl)ethyl]-2-methyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111589068 |
| Molecular Formula | C23H34IN3O4 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1-[2-(3-methoxy-4-methylphenyl)ethyl]-2-methyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(C)c(OC)c1)NCCc1ccc(OC)c(OC)c1OC.I |
| InChI | InChI=1S/C23H33N3O4.HI/c1-16-7-8-17(15-20(16)28-4)11-13-25-23(24-2)26-14-12-18-9-10-19(27-3)22(30-6)21(18)29-5;/h7-10,15H,11-14H2,1-6H3,(H2,24,25,26);1H |
| InChIKey | WFTXMFYEPOLFHR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|