C16H27ClN4 — CID 111177116
2-[(3-chlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-3-ethylguanidine (PubChem CID 111177116) has the molecular formula C16H27ClN4 and a molecular weight of 310.87 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-3-ethylguanidine.
| Compound Name | 2-[(3-chlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111177116 |
| Molecular Formula | C16H27ClN4 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-1-[2-(diethylamino)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cccc(Cl)c1)NCCN(CC)CC |
| InChI | InChI=1S/C16H27ClN4/c1-4-18-16(19-10-11-21(5-2)6-3)20-13-14-8-7-9-15(17)12-14/h7-9,12H,4-6,10-11,13H2,1-3H3,(H2,18,19,20) |
| InChIKey | XCNQSXABWKLKLH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|