C22H29ClN6 — CID 111177690
4-(2-chlorophenyl)-N'-methyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 111177690) has the molecular formula C22H29ClN6 and a molecular weight of 412.97 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N'-methyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N'-methyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111177690 |
| Molecular Formula | C22H29ClN6 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 4-(2-chlorophenyl)-N'-methyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(N2CCCC2)nc1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H29ClN6/c1-24-22(26-17-18-8-9-21(25-16-18)28-10-4-5-11-28)29-14-12-27(13-15-29)20-7-3-2-6-19(20)23/h2-3,6-9,16H,4-5,10-15,17H2,1H3,(H,24,26) |
| InChIKey | ZZFOETPMCBDLCZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|