C19H29N5O — CID 111179665
1-ethyl-3-(2-methylpropyl)-2-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111179665) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylpropyl)-2-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-methylpropyl)-2-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111179665 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 1-ethyl-3-(2-methylpropyl)-2-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCCc1noc(-c2cccc(C/N=C(\NCC)NCC(C)C)c2)n1 |
| InChI | InChI=1S/C19H29N5O/c1-5-8-17-23-18(25-24-17)16-10-7-9-15(11-16)13-22-19(20-6-2)21-12-14(3)4/h7,9-11,14H,5-6,8,12-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | BVMBTWKKLHMVJV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|