C14H20O3 — CID 11118042
methyl (E)-3-(4,5,5-trimethyl-2-prop-1-en-2-ylfuran-2-yl)prop-2-enoate (PubChem CID 11118042) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl (E)-3-(4,5,5-trimethyl-2-prop-1-en-2-ylfuran-2-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(4,5,5-trimethyl-2-prop-1-en-2-ylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 11118042 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl (E)-3-(4,5,5-trimethyl-2-prop-1-en-2-ylfuran-2-yl)prop-2-enoate |
| SMILES | C=C(C)C1(/C=C/C(=O)OC)C=C(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H20O3/c1-10(2)14(8-7-12(15)16-6)9-11(3)13(4,5)17-14/h7-9H,1H2,2-6H3/b8-7+ |
| InChIKey | GODDYDZWAQJBGH-BQYQJAHWSA-N |
| XLogP | 2.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|