About ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate
ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate (PubChem CID 11118146) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate.
Analyze ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate?
The IUPAC name of ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate (CID 11118146) is ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate.
What is the SMILES notation for ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate?
The canonical SMILES for ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate is CCCC(CCC)(C(=O)OCC)C1=NCCC1.
What is the InChIKey of ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate?
The InChIKey is UMVFJSXTWXTRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-4-9-14(10-5-2,13(16)17-6-3)12-8-7-11-15-12/h4-11H2,1-3H3.
What are the key properties of ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate?
ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate has a molecular weight of 239.36 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,4-dihydro-2H-pyrrol-5-yl)-2-propylpentanoate is sourced from PubChem (CID 11118146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).