C20H22N4OS — CID 111182045
1-[(4-methoxyphenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 111182045) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111182045 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(OC)cc1)NCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N4OS/c1-21-20(22-12-15-8-10-18(25-2)11-9-15)23-13-17-14-26-19(24-17)16-6-4-3-5-7-16/h3-11,14H,12-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | SJBCPPBQABFTNN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|