C22H24N4S — CID 111855612
2-methyl-1-[(1-phenylcyclopropyl)methyl]-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 111855612) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is 2-methyl-1-[(1-phenylcyclopropyl)methyl]-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(1-phenylcyclopropyl)methyl]-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111855612 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-methyl-1-[(1-phenylcyclopropyl)methyl]-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1csc(-c2ccccc2)n1)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H24N4S/c1-23-21(25-16-22(12-13-22)18-10-6-3-7-11-18)24-14-19-15-27-20(26-19)17-8-4-2-5-9-17/h2-11,15H,12-14,16H2,1H3,(H2,23,24,25) |
| InChIKey | XPBQOQOBCNQEDL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|