C17H22N4S — CID 111856690
2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-[(1-phenylcyclopropyl)methyl]guanidine (PubChem CID 111856690) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-[(1-phenylcyclopropyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-[(1-phenylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 111856690 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-[(1-phenylcyclopropyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1scnc1C)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H22N4S/c1-13-15(22-12-21-13)10-19-16(18-2)20-11-17(8-9-17)14-6-4-3-5-7-14/h3-7,12H,8-11H2,1-2H3,(H2,18,19,20) |
| InChIKey | FUAKGNLOCVXYAG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|