C13H24O4 — CID 11118275
[(E)-5-(methoxymethoxy)-2,6-dimethylhept-3-en-2-yl] acetate (PubChem CID 11118275) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is [(E)-5-(methoxymethoxy)-2,6-dimethylhept-3-en-2-yl] acetate.
| Compound Name | [(E)-5-(methoxymethoxy)-2,6-dimethylhept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 11118275 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | [(E)-5-(methoxymethoxy)-2,6-dimethylhept-3-en-2-yl] acetate |
| SMILES | COCOC(/C=C/C(C)(C)OC(C)=O)C(C)C |
| InChI | InChI=1S/C13H24O4/c1-10(2)12(16-9-15-6)7-8-13(4,5)17-11(3)14/h7-8,10,12H,9H2,1-6H3/b8-7+ |
| InChIKey | UKPLXLWPUWAWIF-BQYQJAHWSA-N |
| XLogP | 2.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|