C11H20O4 — CID 15383233
tert-butyl (E,4S)-4-(methoxymethoxy)pent-2-enoate (PubChem CID 15383233) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl (E,4S)-4-(methoxymethoxy)pent-2-enoate.
| Compound Name | tert-butyl (E,4S)-4-(methoxymethoxy)pent-2-enoate |
|---|---|
| PubChem CID | 15383233 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | tert-butyl (E,4S)-4-(methoxymethoxy)pent-2-enoate |
| SMILES | COCO[C@@H](C)/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20O4/c1-9(14-8-13-5)6-7-10(12)15-11(2,3)4/h6-7,9H,8H2,1-5H3/b7-6+/t9-/m0/s1 |
| InChIKey | VMEDZJLJDKUPLJ-UCUJLANTSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|