C23H30N6O — CID 111185104
4-(2-hydroxyphenyl)-N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111185104) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-hydroxyphenyl)-N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111185104 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C23H30N6O/c1-18-26-19-8-3-4-9-20(19)29(18)13-7-12-25-23(24-2)28-16-14-27(15-17-28)21-10-5-6-11-22(21)30/h3-6,8-11,30H,7,12-17H2,1-2H3,(H,24,25) |
| InChIKey | MCPCVHHTKIFSGR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|