C22H32IN5O — CID 111185941
N-[2-(dimethylamino)-2-phenylethyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111185941) has the molecular formula C22H32IN5O and a molecular weight of 509.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111185941 |
| Molecular Formula | C22H32IN5O |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccccc1)N(C)C)N1CCN(c2ccccc2O)CC1.I |
| InChI | InChI=1S/C22H31N5O.HI/c1-23-22(24-17-20(25(2)3)18-9-5-4-6-10-18)27-15-13-26(14-16-27)19-11-7-8-12-21(19)28;/h4-12,20,28H,13-17H2,1-3H3,(H,23,24);1H |
| InChIKey | WCLXDTBSZXGBSI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|