C23H33N5O — CID 110961581
N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide (PubChem CID 110961581) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110961581 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | N-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1ccccc1OC)N(C)C)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H33N5O/c1-24-23(28-16-14-27(15-17-28)19-10-6-5-7-11-19)25-18-21(26(2)3)20-12-8-9-13-22(20)29-4/h5-13,21H,14-18H2,1-4H3,(H,24,25) |
| InChIKey | MGELAOOTTPQIRS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|