C19H32IN5 — CID 110962048
N-[2-cyclopropyl-2-(dimethylamino)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110962048) has the molecular formula C19H32IN5 and a molecular weight of 457.40 g/mol. Its IUPAC name is N-[2-cyclopropyl-2-(dimethylamino)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-cyclopropyl-2-(dimethylamino)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110962048 |
| Molecular Formula | C19H32IN5 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[2-cyclopropyl-2-(dimethylamino)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(C1CC1)N(C)C)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C19H31N5.HI/c1-20-19(21-15-18(22(2)3)16-9-10-16)24-13-11-23(12-14-24)17-7-5-4-6-8-17;/h4-8,16,18H,9-15H2,1-3H3,(H,20,21);1H |
| InChIKey | QWMAONRGZVMZDT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|