C14H27N7O — CID 111187751
1-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111187751) has the molecular formula C14H27N7O and a molecular weight of 309.42 g/mol. Its IUPAC name is 1-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111187751 |
| Molecular Formula | C14H27N7O |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 1-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nncn1CC)NCCN1CCOCC1 |
| InChI | InChI=1S/C14H27N7O/c1-3-15-14(16-5-6-20-7-9-22-10-8-20)17-11-13-19-18-12-21(13)4-2/h12H,3-11H2,1-2H3,(H2,15,16,17) |
| InChIKey | KBFBHIUYJVEZDM-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|