C17H35IN4O2 — CID 111190319
1-ethyl-3-(4-hydroxycyclohexyl)-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111190319) has the molecular formula C17H35IN4O2 and a molecular weight of 454.40 g/mol. Its IUPAC name is 1-ethyl-3-(4-hydroxycyclohexyl)-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111190319 |
| Molecular Formula | C17H35IN4O2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCOCC1)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C17H34N4O2.HI/c1-2-18-17(20-15-5-7-16(22)8-6-15)19-9-3-4-10-21-11-13-23-14-12-21;/h15-16,22H,2-14H2,1H3,(H2,18,19,20);1H |
| InChIKey | RHABYDQLKYIRDX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|