C21H36IN5 — CID 111191801
2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111191801) has the molecular formula C21H36IN5 and a molecular weight of 485.46 g/mol. Its IUPAC name is 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111191801 |
| Molecular Formula | C21H36IN5 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C=CCN(CC=C)C(C/N=C(\NCC)NCCc1ccccn1)C(C)C.I |
| InChI | InChI=1S/C21H35N5.HI/c1-6-15-26(16-7-2)20(18(4)5)17-25-21(22-8-3)24-14-12-19-11-9-10-13-23-19;/h6-7,9-11,13,18,20H,1-2,8,12,14-17H2,3-5H3,(H2,22,24,25);1H |
| InChIKey | LNEZGUWKBDTPKI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|