C22H29N5O2 — CID 111192350
N-cyclopropyl-2-[3-[[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111192350) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-[[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[3-[[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111192350 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-cyclopropyl-2-[3-[[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(=O)NC2CC2)c1)NCCc1ccccn1 |
| InChI | InChI=1S/C22H29N5O2/c1-2-23-22(25-13-11-18-7-3-4-12-24-18)26-15-17-6-5-8-20(14-17)29-16-21(28)27-19-9-10-19/h3-8,12,14,19H,2,9-11,13,15-16H2,1H3,(H,27,28)(H2,23,25,26) |
| InChIKey | ZBZCSEOYNCDRJF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|