C23H29ClN4O2 — CID 111357998
2-[3-[[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]-N-cyclopropylacetamide (PubChem CID 111357998) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is 2-[3-[[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]-N-cyclopropylacetamide.
| Compound Name | 2-[3-[[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 111357998 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[3-[[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]-N-cyclopropylacetamide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(=O)NC2CC2)c1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H29ClN4O2/c1-2-25-23(26-12-11-17-5-3-7-19(24)13-17)27-15-18-6-4-8-21(14-18)30-16-22(29)28-20-9-10-20/h3-8,13-14,20H,2,9-12,15-16H2,1H3,(H,28,29)(H2,25,26,27) |
| InChIKey | OTOZUEQGJSCQMH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|