C24H40IN5O2 — CID 111370654
N-cyclopropyl-2-[3-[[[ethylamino-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111370654) has the molecular formula C24H40IN5O2 and a molecular weight of 557.52 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-[[[ethylamino-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[3-[[[ethylamino-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111370654 |
| Molecular Formula | C24H40IN5O2 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | N-cyclopropyl-2-[3-[[[ethylamino-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(=O)NC2CC2)c1)NCCCN1CCCCC1C.I |
| InChI | InChI=1S/C24H39N5O2.HI/c1-3-25-24(26-13-7-15-29-14-5-4-8-19(29)2)27-17-20-9-6-10-22(16-20)31-18-23(30)28-21-11-12-21;/h6,9-10,16,19,21H,3-5,7-8,11-15,17-18H2,1-2H3,(H,28,30)(H2,25,26,27);1H |
| InChIKey | CULANFRKTACERW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|