C24H40N6O2 — CID 111192500
2-methyl-1-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111192500) has the molecular formula C24H40N6O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 2-methyl-1-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111192500 |
| Molecular Formula | C24H40N6O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 2-methyl-1-[6-[4-(3-methylbutanoyl)piperazin-1-yl]-6-oxohexyl]-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCCCCCC(=O)N1CCN(C(=O)CC(C)C)CC1)NCCc1ccccn1 |
| InChI | InChI=1S/C24H40N6O2/c1-20(2)19-23(32)30-17-15-29(16-18-30)22(31)10-5-4-7-13-27-24(25-3)28-14-11-21-9-6-8-12-26-21/h6,8-9,12,20H,4-5,7,10-11,13-19H2,1-3H3,(H2,25,27,28) |
| InChIKey | BPEGGNWTGAMWKV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|