C16H28N4 — CID 111195830
1-ethyl-3-heptan-2-yl-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 111195830) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 1-ethyl-3-heptan-2-yl-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-heptan-2-yl-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111195830 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 1-ethyl-3-heptan-2-yl-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCCCCC(C)N/C(=N/Cc1ccccn1)NCC |
| InChI | InChI=1S/C16H28N4/c1-4-6-7-10-14(3)20-16(17-5-2)19-13-15-11-8-9-12-18-15/h8-9,11-12,14H,4-7,10,13H2,1-3H3,(H2,17,19,20) |
| InChIKey | BKELFODHPRJENK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|