C19H24Cl2IN5 — CID 111197745
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111197745) has the molecular formula C19H24Cl2IN5 and a molecular weight of 520.25 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111197745 |
| Molecular Formula | C19H24Cl2IN5 |
| Molecular Weight | 520.25 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCCC2)nc1)NCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C19H23Cl2N5.HI/c1-22-19(25-13-15-5-6-16(20)10-17(15)21)24-12-14-4-7-18(23-11-14)26-8-2-3-9-26;/h4-7,10-11H,2-3,8-9,12-13H2,1H3,(H2,22,24,25);1H |
| InChIKey | UHLJAILQHFDFJZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|