C21H24Cl2N4O2 — CID 111198010
N-[3-[[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 111198010) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is N-[3-[[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 111198010 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[3-[[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCCO2)c1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N4O2/c1-24-21(26-13-15-7-8-16(22)11-18(15)23)25-12-14-4-2-5-17(10-14)27-20(28)19-6-3-9-29-19/h2,4-5,7-8,10-11,19H,3,6,9,12-13H2,1H3,(H,27,28)(H2,24,25,26) |
| InChIKey | SXCGAMAOJHHRAU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|