C19H20ClN3O3 — CID 60586470
N-[3-[[(3-chlorophenyl)carbamoylamino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 60586470) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is N-[3-[[(3-chlorophenyl)carbamoylamino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[(3-chlorophenyl)carbamoylamino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 60586470 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[3-[[(3-chlorophenyl)carbamoylamino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(NCc1cccc(NC(=O)C2CCCO2)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O3/c20-14-5-2-7-16(11-14)23-19(25)21-12-13-4-1-6-15(10-13)22-18(24)17-8-3-9-26-17/h1-2,4-7,10-11,17H,3,8-9,12H2,(H,22,24)(H2,21,23,25) |
| InChIKey | SSWRALHHQACQMW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |