C19H24F2IN3O — CID 111199745
1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111199745) has the molecular formula C19H24F2IN3O and a molecular weight of 475.32 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111199745 |
| Molecular Formula | C19H24F2IN3O |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccccc1)NCc1cccc(OC(F)F)c1.I |
| InChI | InChI=1S/C19H23F2N3O.HI/c1-22-19(23-12-6-10-15-7-3-2-4-8-15)24-14-16-9-5-11-17(13-16)25-18(20)21;/h2-5,7-9,11,13,18H,6,10,12,14H2,1H3,(H2,22,23,24);1H |
| InChIKey | PHSAYGBSZODDBP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|