C19H24F2IN3O3S — CID 111614297
1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111614297) has the molecular formula C19H24F2IN3O3S and a molecular weight of 539.39 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111614297 |
| Molecular Formula | C19H24F2IN3O3S |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(S(C)(=O)=O)cc1)NCc1cccc(OC(F)F)c1.I |
| InChI | InChI=1S/C19H23F2N3O3S.HI/c1-22-19(24-13-15-4-3-5-16(12-15)27-18(20)21)23-11-10-14-6-8-17(9-7-14)28(2,25)26;/h3-9,12,18H,10-11,13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | CSNKOMDBPZVLSG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|