C22H29N3O2 — CID 111203066
2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[(1-phenylcyclopropyl)methyl]guanidine (PubChem CID 111203066) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[(1-phenylcyclopropyl)methyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[(1-phenylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 111203066 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[(1-phenylcyclopropyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O2/c1-4-23-21(24-15-17-10-11-19(26-2)20(14-17)27-3)25-16-22(12-13-22)18-8-6-5-7-9-18/h5-11,14H,4,12-13,15-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | RHOZMAVBLHPYEJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|