C25H34N4O2 — CID 111852924
N-[5-[[[ethylamino-[(1-phenylcyclopentyl)methylamino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide (PubChem CID 111852924) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[5-[[[ethylamino-[(1-phenylcyclopentyl)methylamino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[[[ethylamino-[(1-phenylcyclopentyl)methylamino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 111852924 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | N-[5-[[[ethylamino-[(1-phenylcyclopentyl)methylamino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(NC(C)=O)c1)NCC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C25H34N4O2/c1-4-26-24(27-17-20-12-13-23(31-3)22(16-20)29-19(2)30)28-18-25(14-8-9-15-25)21-10-6-5-7-11-21/h5-7,10-13,16H,4,8-9,14-15,17-18H2,1-3H3,(H,29,30)(H2,26,27,28) |
| InChIKey | TUHYCMRLTKBNTC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|