C17H24O5 — CID 11120394
methyl (3R,5S,6R,9R)-9-acetyl-6-ethenyl-2-oxo-3-propan-2-yl-1-oxaspiro[4.4]nonane-3-carboxylate (PubChem CID 11120394) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl (3R,5S,6R,9R)-9-acetyl-6-ethenyl-2-oxo-3-propan-2-yl-1-oxaspiro[4.4]nonane-3-carboxylate.
| Compound Name | methyl (3R,5S,6R,9R)-9-acetyl-6-ethenyl-2-oxo-3-propan-2-yl-1-oxaspiro[4.4]nonane-3-carboxylate |
|---|---|
| PubChem CID | 11120394 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl (3R,5S,6R,9R)-9-acetyl-6-ethenyl-2-oxo-3-propan-2-yl-1-oxaspiro[4.4]nonane-3-carboxylate |
| SMILES | C=C[C@H]1CC[C@@H](C(C)=O)[C@]12C[C@](C(=O)OC)(C(C)C)C(=O)O2 |
| InChI | InChI=1S/C17H24O5/c1-6-12-7-8-13(11(4)18)17(12)9-16(10(2)3,14(19)21-5)15(20)22-17/h6,10,12-13H,1,7-9H2,2-5H3/t12-,13-,16+,17-/m0/s1 |
| InChIKey | VBXRUSYWWZAVMZ-CLROSIBMSA-N |
| XLogP | 2.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|